C28H39F2N5O6S — CID 144552810
tert-butyl N-cyclopropyl-N-[6-[[3-(2-hydroxyethoxy)cyclopentyl]amino]-5-nitro-2-propylsulfanylpyrimidin-4-yl]carbamate;1,2-difluorobenzene (PubChem CID 144552810) has the molecular formula C28H39F2N5O6S and a molecular weight of 611.71 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[6-[[3-(2-hydroxyethoxy)cyclopentyl]amino]-5-nitro-2-propylsulfanylpyrimidin-4-yl]carbamate;1,2-difluorobenzene.
| Compound Name | tert-butyl N-cyclopropyl-N-[6-[[3-(2-hydroxyethoxy)cyclopentyl]amino]-5-nitro-2-propylsulfanylpyrimidin-4-yl]carbamate;1,2-difluorobenzene |
|---|---|
| PubChem CID | 144552810 |
| Molecular Formula | C28H39F2N5O6S |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[6-[[3-(2-hydroxyethoxy)cyclopentyl]amino]-5-nitro-2-propylsulfanylpyrimidin-4-yl]carbamate;1,2-difluorobenzene |
| SMILES | CCCSc1nc(NC2CCC(OCCO)C2)c([N+](=O)[O-])c(N(C(=O)OC(C)(C)C)C2CC2)n1.Fc1ccccc1F |
| InChI | InChI=1S/C22H35N5O6S.C6H4F2/c1-5-12-34-20-24-18(23-14-6-9-16(13-14)32-11-10-28)17(27(30)31)19(25-20)26(15-7-8-15)21(29)33-22(2,3)4;7-5-3-1-2-4-6(5)8/h14-16,28H,5-13H2,1-4H3,(H,23,24,25);1-4H |
| InChIKey | XWKZVMOBWMNPCZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|