C24H29FN2O3S — CID 71873909
tert-butyl 4-(2-fluoro-N-(2-phenylsulfanylacetyl)anilino)piperidine-1-carboxylate (PubChem CID 71873909) has the molecular formula C24H29FN2O3S and a molecular weight of 444.57 g/mol. Its IUPAC name is tert-butyl 4-(2-fluoro-N-(2-phenylsulfanylacetyl)anilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluoro-N-(2-phenylsulfanylacetyl)anilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71873909 |
| Molecular Formula | C24H29FN2O3S |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | tert-butyl 4-(2-fluoro-N-(2-phenylsulfanylacetyl)anilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)CSc2ccccc2)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H29FN2O3S/c1-24(2,3)30-23(29)26-15-13-18(14-16-26)27(21-12-8-7-11-20(21)25)22(28)17-31-19-9-5-4-6-10-19/h4-12,18H,13-17H2,1-3H3 |
| InChIKey | REKHJLBQKWBSNJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |