C20H31FN2O3 — CID 143303337
tert-butyl 4-(N-acetyl-4-fluoroanilino)piperidine-1-carboxylate;ethane (PubChem CID 143303337) has the molecular formula C20H31FN2O3 and a molecular weight of 366.48 g/mol. Its IUPAC name is tert-butyl 4-(N-acetyl-4-fluoroanilino)piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(N-acetyl-4-fluoroanilino)piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143303337 |
| Molecular Formula | C20H31FN2O3 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | tert-butyl 4-(N-acetyl-4-fluoroanilino)piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(=O)N(c1ccc(F)cc1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H25FN2O3.C2H6/c1-13(22)21(15-7-5-14(19)6-8-15)16-9-11-20(12-10-16)17(23)24-18(2,3)4;1-2/h5-8,16H,9-12H2,1-4H3;1-2H3 |
| InChIKey | BJNWWZJSLQOTMZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |