C23H34FN5O2 — CID 71866215
tert-butyl 4-[2-fluoro-N-[5-(1,2,4-triazol-1-yl)pentyl]anilino]piperidine-1-carboxylate (PubChem CID 71866215) has the molecular formula C23H34FN5O2 and a molecular weight of 431.56 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-N-[5-(1,2,4-triazol-1-yl)pentyl]anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-N-[5-(1,2,4-triazol-1-yl)pentyl]anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71866215 |
| Molecular Formula | C23H34FN5O2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl 4-[2-fluoro-N-[5-(1,2,4-triazol-1-yl)pentyl]anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(CCCCCn2cncn2)c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H34FN5O2/c1-23(2,3)31-22(30)27-15-11-19(12-16-27)29(21-10-6-5-9-20(21)24)14-8-4-7-13-28-18-25-17-26-28/h5-6,9-10,17-19H,4,7-8,11-16H2,1-3H3 |
| InChIKey | QFNABOAFLJKMOZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|