C15H28N6O2S — CID 126627085
2-[(1R,3S)-3-[amino-[5-amino-6-(methylamino)-2-propylsulfanylpyrimidin-4-yl]amino]cyclopentyl]oxyethanol (PubChem CID 126627085) has the molecular formula C15H28N6O2S and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[(1R,3S)-3-[amino-[5-amino-6-(methylamino)-2-propylsulfanylpyrimidin-4-yl]amino]cyclopentyl]oxyethanol.
| Compound Name | 2-[(1R,3S)-3-[amino-[5-amino-6-(methylamino)-2-propylsulfanylpyrimidin-4-yl]amino]cyclopentyl]oxyethanol |
|---|---|
| PubChem CID | 126627085 |
| Molecular Formula | C15H28N6O2S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-[(1R,3S)-3-[amino-[5-amino-6-(methylamino)-2-propylsulfanylpyrimidin-4-yl]amino]cyclopentyl]oxyethanol |
| SMILES | CCCSc1nc(NC)c(N)c(N(N)[C@H]2CC[C@@H](OCCO)C2)n1 |
| InChI | InChI=1S/C15H28N6O2S/c1-3-8-24-15-19-13(18-2)12(16)14(20-15)21(17)10-4-5-11(9-10)23-7-6-22/h10-11,22H,3-9,16-17H2,1-2H3,(H,18,19,20)/t10-,11+/m0/s1 |
| InChIKey | ZRMURVPCOUZUJN-WDEREUQCSA-N |
| XLogP | 1.21 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|