C16H26ClN5O5S — CID 123502476
ethyl 2-[4-[amino-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]oxyacetate (PubChem CID 123502476) has the molecular formula C16H26ClN5O5S and a molecular weight of 435.93 g/mol. Its IUPAC name is ethyl 2-[4-[amino-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]oxyacetate.
| Compound Name | ethyl 2-[4-[amino-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]oxyacetate |
|---|---|
| PubChem CID | 123502476 |
| Molecular Formula | C16H26ClN5O5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | ethyl 2-[4-[amino-(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]oxyacetate |
| SMILES | CCCSc1nc(Cl)c(N)c(N(N)C2CC(OCC(=O)OCC)C(O)C2O)n1 |
| InChI | InChI=1S/C16H26ClN5O5S/c1-3-5-28-16-20-14(17)11(18)15(21-16)22(19)8-6-9(13(25)12(8)24)27-7-10(23)26-4-2/h8-9,12-13,24-25H,3-7,18-19H2,1-2H3 |
| InChIKey | LCYVKFLDYXSCTF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|