C11H14N2S — CID 130817083
2,4-dimethyl-6-propylsulfanylpyridine-3-carbonitrile (PubChem CID 130817083) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,4-dimethyl-6-propylsulfanylpyridine-3-carbonitrile.
| Compound Name | 2,4-dimethyl-6-propylsulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130817083 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,4-dimethyl-6-propylsulfanylpyridine-3-carbonitrile |
| SMILES | CCCSc1cc(C)c(C#N)c(C)n1 |
| InChI | InChI=1S/C11H14N2S/c1-4-5-14-11-6-8(2)10(7-12)9(3)13-11/h6H,4-5H2,1-3H3 |
| InChIKey | FAXVMLSZMCYPRL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |