About 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile
4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 81052061) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile.
Analyze 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile?
The IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile (CID 81052061) is 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile.
What is the SMILES notation for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile?
The canonical SMILES for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile is CCSc1cc(C)nc(C)c1C#N.
What is the InChIKey of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile?
The InChIKey is ANMKZJBMNDRQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-4-13-10-5-7(2)12-8(3)9(10)6-11/h5H,4H2,1-3H3.
What are the key properties of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile?
4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile has a molecular weight of 192.29 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carbonitrile is sourced from PubChem (CID 81052061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).