C16H16N6S — CID 133396948
2,6-dimethyl-4-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]pyridine-3-carbonitrile (PubChem CID 133396948) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]pyridine-3-carbonitrile.
| Compound Name | 2,6-dimethyl-4-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133396948 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2,6-dimethyl-4-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]pyridine-3-carbonitrile |
| SMILES | Cc1cc(Sc2nc3nc(C)c(C)c(C)n3n2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C16H16N6S/c1-8-6-14(13(7-17)11(4)18-8)23-16-20-15-19-10(3)9(2)12(5)22(15)21-16/h6H,1-5H3 |
| InChIKey | JVDSKXHGZFRVJA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |