4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid

C10H13NO2S — CID 81053869

IUPAC4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid
SMILESCCSc1cc(C)nc(C)c1C(=O)O
InChIInChI=1S/C10H13NO2S/c1-4-14-8-5-6(2)11-7(3)9(8)10(12)13/h5H,4H2,1-3H3,(H,12,13)
InChIKeyMRNSCQQLJBSNPS-UHFFFAOYSA-N
MW211.29 g/mol
LogP2.51
Rot. Bonds3

About 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid

4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 81053869) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid
PubChem CID81053869
Molecular FormulaC10H13NO2S
Molecular Weight211.29 g/mol
Exact Mass211.07
IUPAC Name4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid
SMILESCCSc1cc(C)nc(C)c1C(=O)O
InChIInChI=1S/C10H13NO2S/c1-4-14-8-5-6(2)11-7(3)9(8)10(12)13/h5H,4H2,1-3H3,(H,12,13)
InChIKeyMRNSCQQLJBSNPS-UHFFFAOYSA-N
XLogP2.51
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.29
LogP ≤ 52.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Methyl-6-phenylpyridine-3-carboxylic acid
CID 822960
2-Methyl-6-(thiophen-2-yl)pyridine-3-carboxylic acid
CID 8893255
2,6-Dimethylpyridine-3,5-dicarboxylic acid
CID 296010
2,6-Dimethyl-4-(3-thienyl)pyridine-3,5-dicarboxylic acid
CID 2739786
2,6-Dimethyl-4-(2-thienyl)pyridine-3,5-dicarboxylic acid
CID 2740771
2-Methyl-6-(trifluoromethyl)nicotinic acid
CID 2775683
2,6-Dimethylnicotinic acid
CID 11715203
3-Pyridinecarboxylic acid, 6-methyl-2-(phenylthio)-
CID 809546
Methyl 2-methyl-6-(thiophen-2-yl)nicotinate
CID 2795949
2,6-Dimethylpyridine-3-carboxylic acid hydrochloride
CID 53407276
2,5,6-Trimethylpyridine-3-carboxylic acid
CID 53922379
2,4,6-trimethylpyridine-3-carboxylic Acid
CID 2753085

Frequently Asked Questions

What is the IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid (CID 81053869) is 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid is CCSc1cc(C)nc(C)c1C(=O)O.
What is the InChIKey of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is MRNSCQQLJBSNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-4-14-8-5-6(2)11-7(3)9(8)10(12)13/h5H,4H2,1-3H3,(H,12,13).
What are the key properties of 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid?
4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 211.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 81053869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).