C8H7N5 — CID 130885262
6-azido-2,4-dimethylpyridine-3-carbonitrile (PubChem CID 130885262) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 6-azido-2,4-dimethylpyridine-3-carbonitrile.
| Compound Name | 6-azido-2,4-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130885262 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 6-azido-2,4-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(N=[N+]=[N-])nc(C)c1C#N |
| InChI | InChI=1S/C8H7N5/c1-5-3-8(12-13-10)11-6(2)7(5)4-9/h3H,1-2H3 |
| InChIKey | JVCRAHUEVAIPCS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|