C15H21N3OS2 — CID 118050425
4-methyl-6-morpholin-4-yl-2-(propylsulfanylmethylsulfanyl)pyridine-3-carbonitrile (PubChem CID 118050425) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is 4-methyl-6-morpholin-4-yl-2-(propylsulfanylmethylsulfanyl)pyridine-3-carbonitrile.
| Compound Name | 4-methyl-6-morpholin-4-yl-2-(propylsulfanylmethylsulfanyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118050425 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-methyl-6-morpholin-4-yl-2-(propylsulfanylmethylsulfanyl)pyridine-3-carbonitrile |
| SMILES | CCCSCSc1nc(N2CCOCC2)cc(C)c1C#N |
| InChI | InChI=1S/C15H21N3OS2/c1-3-8-20-11-21-15-13(10-16)12(2)9-14(17-15)18-4-6-19-7-5-18/h9H,3-8,11H2,1-2H3 |
| InChIKey | QNRZCMUVVPZTKC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|