C24H36N6O2S2 — CID 14397680
4-[6-methyl-2-[6-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidin-4-yl]morpholine (PubChem CID 14397680) has the molecular formula C24H36N6O2S2 and a molecular weight of 504.73 g/mol. Its IUPAC name is 4-[6-methyl-2-[6-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-methyl-2-[6-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 14397680 |
| Molecular Formula | C24H36N6O2S2 |
| Molecular Weight | 504.73 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-[6-methyl-2-[6-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)sulfanylhexylsulfanyl]pyrimidin-4-yl]morpholine |
| SMILES | Cc1cc(N2CCOCC2)nc(SCCCCCCSc2nc(C)cc(N3CCOCC3)n2)n1 |
| InChI | InChI=1S/C24H36N6O2S2/c1-19-17-21(29-7-11-31-12-8-29)27-23(25-19)33-15-5-3-4-6-16-34-24-26-20(2)18-22(28-24)30-9-13-32-14-10-30/h17-18H,3-16H2,1-2H3 |
| InChIKey | OQKFDYFMCHVQPR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|