C23H26N6OS — CID 166795668
6-[2-methyl-5-(propylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile (PubChem CID 166795668) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 6-[2-methyl-5-(propylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile.
| Compound Name | 6-[2-methyl-5-(propylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 166795668 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 6-[2-methyl-5-(propylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile |
| SMILES | CCCSNc1ccc(C)c(Nc2ccc3ncc(N4CCOCC4)nc3c2C#N)c1 |
| InChI | InChI=1S/C23H26N6OS/c1-3-12-31-28-17-5-4-16(2)21(13-17)26-19-6-7-20-23(18(19)14-24)27-22(15-25-20)29-8-10-30-11-9-29/h4-7,13,15,26,28H,3,8-12H2,1-2H3 |
| InChIKey | AJKBJUULXTUFAS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|