C20H19FN6OS — CID 166795648
6-[2-fluoro-5-(methylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile (PubChem CID 166795648) has the molecular formula C20H19FN6OS and a molecular weight of 410.48 g/mol. Its IUPAC name is 6-[2-fluoro-5-(methylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile.
| Compound Name | 6-[2-fluoro-5-(methylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 166795648 |
| Molecular Formula | C20H19FN6OS |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 6-[2-fluoro-5-(methylsulfanylamino)anilino]-3-morpholin-4-ylquinoxaline-5-carbonitrile |
| SMILES | CSNc1ccc(F)c(Nc2ccc3ncc(N4CCOCC4)nc3c2C#N)c1 |
| InChI | InChI=1S/C20H19FN6OS/c1-29-26-13-2-3-15(21)18(10-13)24-16-4-5-17-20(14(16)11-22)25-19(12-23-17)27-6-8-28-9-7-27/h2-5,10,12,24,26H,6-9H2,1H3 |
| InChIKey | XVZGANVKBCIZEM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|