C15H14N2OS2 — CID 54293871
4-amino-5-benzoyl-2-propylsulfanylthiophene-3-carbonitrile (PubChem CID 54293871) has the molecular formula C15H14N2OS2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-amino-5-benzoyl-2-propylsulfanylthiophene-3-carbonitrile.
| Compound Name | 4-amino-5-benzoyl-2-propylsulfanylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 54293871 |
| Molecular Formula | C15H14N2OS2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-amino-5-benzoyl-2-propylsulfanylthiophene-3-carbonitrile |
| SMILES | CCCSc1sc(C(=O)c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C15H14N2OS2/c1-2-8-19-15-11(9-16)12(17)14(20-15)13(18)10-6-4-3-5-7-10/h3-7H,2,8,17H2,1H3 |
| InChIKey | RZKOUKSAVVUKPT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |