C20H16N2O3S2 — CID 11784254
4-amino-5-benzoyl-2-phenacylsulfanylthiophene-3-carboxamide (PubChem CID 11784254) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-amino-5-benzoyl-2-phenacylsulfanylthiophene-3-carboxamide.
| Compound Name | 4-amino-5-benzoyl-2-phenacylsulfanylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 11784254 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-amino-5-benzoyl-2-phenacylsulfanylthiophene-3-carboxamide |
| SMILES | NC(=O)c1c(SCC(=O)c2ccccc2)sc(C(=O)c2ccccc2)c1N |
| InChI | InChI=1S/C20H16N2O3S2/c21-16-15(19(22)25)20(26-11-14(23)12-7-3-1-4-8-12)27-18(16)17(24)13-9-5-2-6-10-13/h1-10H,11,21H2,(H2,22,25) |
| InChIKey | YAKBCCJVSIEYMM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |