C15H14Cl3N3O2S — CID 174799305
ethyl 2-sulfanyl-2-(2,3,5-trichloro-4,6-dicyanoanilino)pentanoate (PubChem CID 174799305) has the molecular formula C15H14Cl3N3O2S and a molecular weight of 406.72 g/mol. Its IUPAC name is ethyl 2-sulfanyl-2-(2,3,5-trichloro-4,6-dicyanoanilino)pentanoate.
| Compound Name | ethyl 2-sulfanyl-2-(2,3,5-trichloro-4,6-dicyanoanilino)pentanoate |
|---|---|
| PubChem CID | 174799305 |
| Molecular Formula | C15H14Cl3N3O2S |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | ethyl 2-sulfanyl-2-(2,3,5-trichloro-4,6-dicyanoanilino)pentanoate |
| SMILES | CCCC(S)(Nc1c(Cl)c(Cl)c(C#N)c(Cl)c1C#N)C(=O)OCC |
| InChI | InChI=1S/C15H14Cl3N3O2S/c1-3-5-15(24,14(22)23-4-2)21-13-9(7-20)10(16)8(6-19)11(17)12(13)18/h21,24H,3-5H2,1-2H3 |
| InChIKey | DTEIVESZJGDTSG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|