C14H17ClN2O2 — CID 55078801
methyl 2-(4-chloro-2-cyanoanilino)-2-methylpentanoate (PubChem CID 55078801) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is methyl 2-(4-chloro-2-cyanoanilino)-2-methylpentanoate.
| Compound Name | methyl 2-(4-chloro-2-cyanoanilino)-2-methylpentanoate |
|---|---|
| PubChem CID | 55078801 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | methyl 2-(4-chloro-2-cyanoanilino)-2-methylpentanoate |
| SMILES | CCCC(C)(Nc1ccc(Cl)cc1C#N)C(=O)OC |
| InChI | InChI=1S/C14H17ClN2O2/c1-4-7-14(2,13(18)19-3)17-12-6-5-11(15)8-10(12)9-16/h5-6,8,17H,4,7H2,1-3H3 |
| InChIKey | MYJXGSRMSSGXMK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |