C13H18ClN3 — CID 115306119
2-[(2-amino-2-ethylbutyl)amino]-5-chlorobenzonitrile (PubChem CID 115306119) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 2-[(2-amino-2-ethylbutyl)amino]-5-chlorobenzonitrile.
| Compound Name | 2-[(2-amino-2-ethylbutyl)amino]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 115306119 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-[(2-amino-2-ethylbutyl)amino]-5-chlorobenzonitrile |
| SMILES | CCC(N)(CC)CNc1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C13H18ClN3/c1-3-13(16,4-2)9-17-12-6-5-11(14)7-10(12)8-15/h5-7,17H,3-4,9,16H2,1-2H3 |
| InChIKey | HDBSXFVXIXOJQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |