C11H12ClN3O — CID 62492640
2-(4-chloro-2-cyanoanilino)-N,N-dimethylacetamide (PubChem CID 62492640) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 2-(4-chloro-2-cyanoanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(4-chloro-2-cyanoanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 62492640 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(4-chloro-2-cyanoanilino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C11H12ClN3O/c1-15(2)11(16)7-14-10-4-3-9(12)5-8(10)6-13/h3-5,14H,7H2,1-2H3 |
| InChIKey | IGAZLKBHVDDMMP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |