C11H14N4O — CID 61296173
2-(4-amino-2-cyanoanilino)-N,N-dimethylacetamide (PubChem CID 61296173) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(4-amino-2-cyanoanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(4-amino-2-cyanoanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 61296173 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-(4-amino-2-cyanoanilino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1ccc(N)cc1C#N |
| InChI | InChI=1S/C11H14N4O/c1-15(2)11(16)7-14-10-4-3-9(13)5-8(10)6-12/h3-5,14H,7,13H2,1-2H3 |
| InChIKey | JBKYUJUJFVKWLN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|