C11H15N3O2 — CID 66168200
5-amino-2-[(2,3-dihydroxy-2-methylpropyl)amino]benzonitrile (PubChem CID 66168200) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-amino-2-[(2,3-dihydroxy-2-methylpropyl)amino]benzonitrile.
| Compound Name | 5-amino-2-[(2,3-dihydroxy-2-methylpropyl)amino]benzonitrile |
|---|---|
| PubChem CID | 66168200 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-amino-2-[(2,3-dihydroxy-2-methylpropyl)amino]benzonitrile |
| SMILES | CC(O)(CO)CNc1ccc(N)cc1C#N |
| InChI | InChI=1S/C11H15N3O2/c1-11(16,7-15)6-14-10-3-2-9(13)4-8(10)5-12/h2-4,14-16H,6-7,13H2,1H3 |
| InChIKey | PBCTTWXGNNVVMB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|