C12H14ClN3O — CID 106096695
3-(4-chloro-2-cyanoanilino)-3-methylbutanamide (PubChem CID 106096695) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 3-(4-chloro-2-cyanoanilino)-3-methylbutanamide.
| Compound Name | 3-(4-chloro-2-cyanoanilino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106096695 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-(4-chloro-2-cyanoanilino)-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C12H14ClN3O/c1-12(2,6-11(15)17)16-10-4-3-9(13)5-8(10)7-14/h3-5,16H,6H2,1-2H3,(H2,15,17) |
| InChIKey | SGQWRNLXQHGMEC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |