C7ClF4N — CID 11615422
3-chloro-2,4,5,6-tetrafluorobenzonitrile (PubChem CID 11615422) has the molecular formula C7ClF4N and a molecular weight of 209.53 g/mol. Its IUPAC name is 3-chloro-2,4,5,6-tetrafluorobenzonitrile.
| Compound Name | 3-chloro-2,4,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 11615422 |
| Molecular Formula | C7ClF4N |
| Molecular Weight | 209.53 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | 3-chloro-2,4,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(F)c(Cl)c1F |
| InChI | InChI=1S/C7ClF4N/c8-3-4(9)2(1-13)5(10)7(12)6(3)11 |
| InChIKey | SMPPDKRKAOZGQO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|