About 3-chloro-2,6-difluorobenzonitrile
3-chloro-2,6-difluorobenzonitrile (PubChem CID 13175231) has the molecular formula C7H2ClF2N
and a molecular weight of 173.55 g/mol. Its IUPAC name is 3-chloro-2,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 3-chloro-2,6-difluorobenzonitrile |
| PubChem CID | 13175231 |
| Molecular Formula | C7H2ClF2N |
| Molecular Weight | 173.55 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 3-chloro-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C7H2ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H |
| InChIKey | QYALCKFGISNFMJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-difluorobenzonitrile?
The IUPAC name of 3-chloro-2,6-difluorobenzonitrile (CID 13175231) is 3-chloro-2,6-difluorobenzonitrile.
What is the SMILES notation for 3-chloro-2,6-difluorobenzonitrile?
The canonical SMILES for 3-chloro-2,6-difluorobenzonitrile is N#Cc1c(F)ccc(Cl)c1F.
What is the InChIKey of 3-chloro-2,6-difluorobenzonitrile?
The InChIKey is QYALCKFGISNFMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H.
What are the key properties of 3-chloro-2,6-difluorobenzonitrile?
3-chloro-2,6-difluorobenzonitrile has a molecular weight of 173.55 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-difluorobenzonitrile is sourced from PubChem (CID 13175231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).