C6HBrCl2N2 — CID 154809886
4-bromo-2,6-dichloropyridine-3-carbonitrile (PubChem CID 154809886) has the molecular formula C6HBrCl2N2 and a molecular weight of 251.90 g/mol. Its IUPAC name is 4-bromo-2,6-dichloropyridine-3-carbonitrile.
| Compound Name | 4-bromo-2,6-dichloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154809886 |
| Molecular Formula | C6HBrCl2N2 |
| Molecular Weight | 251.90 g/mol |
| Exact Mass | 249.87 |
| IUPAC Name | 4-bromo-2,6-dichloropyridine-3-carbonitrile |
| SMILES | N#Cc1c(Br)cc(Cl)nc1Cl |
| InChI | InChI=1S/C6HBrCl2N2/c7-4-1-5(8)11-6(9)3(4)2-10/h1H |
| InChIKey | NVUJBACOJLHBDK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|