About 4-bromo-2,6-dichloro-3-nitropyridine
4-bromo-2,6-dichloro-3-nitropyridine (PubChem CID 118338335) has the molecular formula C5HBrCl2N2O2
and a molecular weight of 271.88 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-3-nitropyridine.
Molecular Properties
| Compound Name | 4-bromo-2,6-dichloro-3-nitropyridine |
| PubChem CID | 118338335 |
| Molecular Formula | C5HBrCl2N2O2 |
| Molecular Weight | 271.88 g/mol |
| Exact Mass | 269.86 |
| IUPAC Name | 4-bromo-2,6-dichloro-3-nitropyridine |
| SMILES | O=[N+]([O-])c1c(Br)cc(Cl)nc1Cl |
| InChI | InChI=1S/C5HBrCl2N2O2/c6-2-1-3(7)9-5(8)4(2)10(11)12/h1H |
| InChIKey | OKSCYZTVDCGTTG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-dichloro-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dichloro-3-nitropyridine?
The IUPAC name of 4-bromo-2,6-dichloro-3-nitropyridine (CID 118338335) is 4-bromo-2,6-dichloro-3-nitropyridine.
What is the SMILES notation for 4-bromo-2,6-dichloro-3-nitropyridine?
The canonical SMILES for 4-bromo-2,6-dichloro-3-nitropyridine is O=[N+]([O-])c1c(Br)cc(Cl)nc1Cl.
What is the InChIKey of 4-bromo-2,6-dichloro-3-nitropyridine?
The InChIKey is OKSCYZTVDCGTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HBrCl2N2O2/c6-2-1-3(7)9-5(8)4(2)10(11)12/h1H.
What are the key properties of 4-bromo-2,6-dichloro-3-nitropyridine?
4-bromo-2,6-dichloro-3-nitropyridine has a molecular weight of 271.88 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dichloro-3-nitropyridine is sourced from PubChem (CID 118338335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).