methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate

C8H6Cl2N2O4 — CID 87452513

IUPACmethyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate
SMILESCOC(=O)Cc1cc(Cl)nc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C8H6Cl2N2O4/c1-16-6(13)3-4-2-5(9)11-8(10)7(4)12(14)15/h2H,3H2,1H3
InChIKeyBOIJCJZWACKAOX-UHFFFAOYSA-N
MW265.05 g/mol
LogP2.01
Rot. Bonds3

About methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate

methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate (PubChem CID 87452513) has the molecular formula C8H6Cl2N2O4 and a molecular weight of 265.05 g/mol. Its IUPAC name is methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate.

Molecular Properties

Compound Namemethyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate
PubChem CID87452513
Molecular FormulaC8H6Cl2N2O4
Molecular Weight265.05 g/mol
Exact Mass263.97
IUPAC Namemethyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate
SMILESCOC(=O)Cc1cc(Cl)nc(Cl)c1[N+](=O)[O-]
InChIInChI=1S/C8H6Cl2N2O4/c1-16-6(13)3-4-2-5(9)11-8(10)7(4)12(14)15/h2H,3H2,1H3
InChIKeyBOIJCJZWACKAOX-UHFFFAOYSA-N
XLogP2.01
TPSA82.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.05
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate?
The IUPAC name of methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate (CID 87452513) is methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate.
What is the SMILES notation for methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate?
The canonical SMILES for methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate is COC(=O)Cc1cc(Cl)nc(Cl)c1[N+](=O)[O-].
What is the InChIKey of methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate?
The InChIKey is BOIJCJZWACKAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O4/c1-16-6(13)3-4-2-5(9)11-8(10)7(4)12(14)15/h2H,3H2,1H3.
What are the key properties of methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate?
methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate has a molecular weight of 265.05 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-dichloro-3-nitro-4-pyridinyl)acetate is sourced from PubChem (CID 87452513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).