C6HCl3N2 — CID 154089690
2,3,6-trichloropyridine-4-carbonitrile (PubChem CID 154089690) has the molecular formula C6HCl3N2 and a molecular weight of 207.45 g/mol. Its IUPAC name is 2,3,6-trichloropyridine-4-carbonitrile.
| Compound Name | 2,3,6-trichloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 154089690 |
| Molecular Formula | C6HCl3N2 |
| Molecular Weight | 207.45 g/mol |
| Exact Mass | 205.92 |
| IUPAC Name | 2,3,6-trichloropyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(Cl)c1Cl |
| InChI | InChI=1S/C6HCl3N2/c7-4-1-3(2-10)5(8)6(9)11-4/h1H |
| InChIKey | DFWSUWDTOFSBOA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|