C10H2Cl6N2 — CID 14044309
2,3,6-trichloro-4-(2,3,6-trichloro-4-pyridinyl)pyridine (PubChem CID 14044309) has the molecular formula C10H2Cl6N2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 2,3,6-trichloro-4-(2,3,6-trichloro-4-pyridinyl)pyridine.
| Compound Name | 2,3,6-trichloro-4-(2,3,6-trichloro-4-pyridinyl)pyridine |
|---|---|
| PubChem CID | 14044309 |
| Molecular Formula | C10H2Cl6N2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 359.83 |
| IUPAC Name | 2,3,6-trichloro-4-(2,3,6-trichloro-4-pyridinyl)pyridine |
| SMILES | Clc1cc(-c2cc(Cl)nc(Cl)c2Cl)c(Cl)c(Cl)n1 |
| InChI | InChI=1S/C10H2Cl6N2/c11-5-1-3(7(13)9(15)17-5)4-2-6(12)18-10(16)8(4)14/h1-2H |
| InChIKey | PRYYAXKRCJWXRH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|