C7H4Cl3N3 — CID 163273649
2,4,6-trichloro-1-methylimidazo[4,5-c]pyridine (PubChem CID 163273649) has the molecular formula C7H4Cl3N3 and a molecular weight of 236.49 g/mol. Its IUPAC name is 2,4,6-trichloro-1-methylimidazo[4,5-c]pyridine.
| Compound Name | 2,4,6-trichloro-1-methylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 163273649 |
| Molecular Formula | C7H4Cl3N3 |
| Molecular Weight | 236.49 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | 2,4,6-trichloro-1-methylimidazo[4,5-c]pyridine |
| SMILES | Cn1c(Cl)nc2c(Cl)nc(Cl)cc21 |
| InChI | InChI=1S/C7H4Cl3N3/c1-13-3-2-4(8)11-6(9)5(3)12-7(13)10/h2H,1H3 |
| InChIKey | AZUBONCBPJCPKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|