C12H12Cl2N4O — CID 164757852
(1S,4S)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 164757852) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is (1S,4S)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 164757852 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (1S,4S)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Cn1c(N2C[C@@H]3C[C@H]2CO3)nc2c(Cl)nc(Cl)cc21 |
| InChI | InChI=1S/C12H12Cl2N4O/c1-17-8-3-9(13)15-11(14)10(8)16-12(17)18-4-7-2-6(18)5-19-7/h3,6-7H,2,4-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | OYNWSAYBOWFHMX-BQBZGAKWSA-N |
| XLogP | 2.25 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|