C13H14Cl2N4O — CID 163273404
(3aS,6aR)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 163273404) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is (3aS,6aR)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 163273404 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (3aS,6aR)-5-(4,6-dichloro-1-methylimidazo[4,5-c]pyridin-2-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | Cn1c(N2C[C@H]3COC[C@H]3C2)nc2c(Cl)nc(Cl)cc21 |
| InChI | InChI=1S/C13H14Cl2N4O/c1-18-9-2-10(14)16-12(15)11(9)17-13(18)19-3-7-5-20-6-8(7)4-19/h2,7-8H,3-6H2,1H3/t7-,8+ |
| InChIKey | PNDJEJAPYFKHRP-OCAPTIKFSA-N |
| XLogP | 2.36 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|