C19H25ClN6O2 — CID 163273569
8-[6-chloro-1-methyl-4-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]imidazo[4,5-c]pyridin-2-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 163273569) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 8-[6-chloro-1-methyl-4-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]imidazo[4,5-c]pyridin-2-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | 8-[6-chloro-1-methyl-4-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]imidazo[4,5-c]pyridin-2-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 163273569 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 8-[6-chloro-1-methyl-4-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]imidazo[4,5-c]pyridin-2-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Cn1c(N2CCN3CCOCC3C2)nc2c(N3C[C@H]4C[C@@H]3CO4)nc(Cl)cc21 |
| InChI | InChI=1S/C19H25ClN6O2/c1-23-15-7-16(20)21-18(26-9-14-6-12(26)11-28-14)17(15)22-19(23)25-3-2-24-4-5-27-10-13(24)8-25/h7,12-14H,2-6,8-11H2,1H3/t12-,13?,14-/m1/s1 |
| InChIKey | IHNJYBGKWNTMHC-WYAMFQBQSA-N |
| XLogP | 1.12 |
| TPSA | 58.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|