About 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane
5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 131048767) has the molecular formula C9H9Cl2N3O
and a molecular weight of 246.10 g/mol. Its IUPAC name is 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| PubChem CID | 131048767 |
| Molecular Formula | C9H9Cl2N3O |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Clc1cc(N2CC3CC2CO3)nc(Cl)n1 |
| InChI | InChI=1S/C9H9Cl2N3O/c10-7-2-8(13-9(11)12-7)14-3-6-1-5(14)4-15-6/h2,5-6H,1,3-4H2 |
| InChIKey | SXDTWMDTRRYAIK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The IUPAC name of 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (CID 131048767) is 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
What is the SMILES notation for 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The canonical SMILES for 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane is Clc1cc(N2CC3CC2CO3)nc(Cl)n1.
What is the InChIKey of 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The InChIKey is SXDTWMDTRRYAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3O/c10-7-2-8(13-9(11)12-7)14-3-6-1-5(14)4-15-6/h2,5-6H,1,3-4H2.
What are the key properties of 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane has a molecular weight of 246.10 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dichloropyrimidin-4-yl)-2-oxa-5-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 131048767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).