C9H12N4O — CID 131187094
4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pyrimidin-2-amine (PubChem CID 131187094) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pyrimidin-2-amine.
| Compound Name | 4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 131187094 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pyrimidin-2-amine |
| SMILES | Nc1nccc(N2CC3CC2CO3)n1 |
| InChI | InChI=1S/C9H12N4O/c10-9-11-2-1-8(12-9)13-4-7-3-6(13)5-14-7/h1-2,6-7H,3-5H2,(H2,10,11,12) |
| InChIKey | BHFAONDVJMXWBS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |