C16H16BN3O2 — CID 169212568
CID 169212568 (PubChem CID 169212568) has the molecular formula C16H16BN3O2 and a molecular weight of 293.13 g/mol.
| Compound Name | CID 169212568 |
|---|---|
| PubChem CID | 169212568 |
| Molecular Formula | C16H16BN3O2 |
| Molecular Weight | 293.13 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(C)=O)c2nc(N3CC4CC4C3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C16H16BN3O2/c1-8(21)12-4-11(17)5-13-14(12)18-16(19(2)15(13)22)20-6-9-3-10(9)7-20/h4-5,9-10H,3,6-7H2,1-2H3 |
| InChIKey | IQYPUASUOZXKRD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|