C9H8ClN3O2 — CID 168827001
2-chloro-1,4-dimethyl-5-nitrobenzimidazole (PubChem CID 168827001) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.64 g/mol. Its IUPAC name is 2-chloro-1,4-dimethyl-5-nitrobenzimidazole.
| Compound Name | 2-chloro-1,4-dimethyl-5-nitrobenzimidazole |
|---|---|
| PubChem CID | 168827001 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-chloro-1,4-dimethyl-5-nitrobenzimidazole |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1nc(Cl)n2C |
| InChI | InChI=1S/C9H8ClN3O2/c1-5-6(13(14)15)3-4-7-8(5)11-9(10)12(7)2/h3-4H,1-2H3 |
| InChIKey | KVZMLVYEHJDIHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|