C16H11Cl2N3O2 — CID 46877419
2-chloro-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride (PubChem CID 46877419) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 2-chloro-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride.
| Compound Name | 2-chloro-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride |
|---|---|
| PubChem CID | 46877419 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-chloro-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride |
| SMILES | Cl.Cn1c2c3cccc([N+](=O)[O-])c3nc-2cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H10ClN3O2.ClH/c1-19-13-6-5-10(17)7-9(13)8-12-16(19)11-3-2-4-14(20(21)22)15(11)18-12;/h2-8H,1H3;1H |
| InChIKey | XUBASELICLQTKP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|