C13H7ClF2N4O2 — CID 139581569
4-chloro-2-(3,5-difluoro-4-pyridinyl)-1-methyl-5-nitrobenzimidazole (PubChem CID 139581569) has the molecular formula C13H7ClF2N4O2 and a molecular weight of 324.67 g/mol. Its IUPAC name is 4-chloro-2-(3,5-difluoro-4-pyridinyl)-1-methyl-5-nitrobenzimidazole.
| Compound Name | 4-chloro-2-(3,5-difluoro-4-pyridinyl)-1-methyl-5-nitrobenzimidazole |
|---|---|
| PubChem CID | 139581569 |
| Molecular Formula | C13H7ClF2N4O2 |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-chloro-2-(3,5-difluoro-4-pyridinyl)-1-methyl-5-nitrobenzimidazole |
| SMILES | Cn1c(-c2c(F)cncc2F)nc2c(Cl)c([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H7ClF2N4O2/c1-19-9-3-2-8(20(21)22)11(14)12(9)18-13(19)10-6(15)4-17-5-7(10)16/h2-5H,1H3 |
| InChIKey | BPTMBWXZRQVNPJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|