C11H13ClN4O2 — CID 141387354
2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine (PubChem CID 141387354) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 141387354 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc2c(Cl)c([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C11H13ClN4O2/c1-14(2)5-6-15-9-3-4-10(16(17)18)11(12)8(9)7-13-15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WRDXTZJUIGXQTA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|