About 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine
2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine (PubChem CID 141387354) has the molecular formula C11H13ClN4O2
and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 141387354 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc2c(Cl)c([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C11H13ClN4O2/c1-14(2)5-6-15-9-3-4-10(16(17)18)11(12)8(9)7-13-15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WRDXTZJUIGXQTA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine (CID 141387354) is 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine is CN(C)CCn1ncc2c(Cl)c([N+](=O)[O-])ccc21.
What is the InChIKey of 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine?
The InChIKey is WRDXTZJUIGXQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4O2/c1-14(2)5-6-15-9-3-4-10(16(17)18)11(12)8(9)7-13-15/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine?
2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine has a molecular weight of 268.70 g/mol, XLogP of 2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-5-nitroindazol-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 141387354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).