C12H16N4O3 — CID 46228355
2-(3-methoxy-5-nitroindazol-1-yl)-N,N-dimethylethanamine (PubChem CID 46228355) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(3-methoxy-5-nitroindazol-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(3-methoxy-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 46228355 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(3-methoxy-5-nitroindazol-1-yl)-N,N-dimethylethanamine |
| SMILES | COc1nn(CCN(C)C)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C12H16N4O3/c1-14(2)6-7-15-11-5-4-9(16(17)18)8-10(11)12(13-15)19-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | QIYRBCFMSYUGGJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|