C16H11Cl2N3O4 — CID 110169807
(1-ethyl-5-nitroindazol-3-yl) 2,6-dichlorobenzoate (PubChem CID 110169807) has the molecular formula C16H11Cl2N3O4 and a molecular weight of 380.19 g/mol. Its IUPAC name is (1-ethyl-5-nitroindazol-3-yl) 2,6-dichlorobenzoate.
| Compound Name | (1-ethyl-5-nitroindazol-3-yl) 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 110169807 |
| Molecular Formula | C16H11Cl2N3O4 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (1-ethyl-5-nitroindazol-3-yl) 2,6-dichlorobenzoate |
| SMILES | CCn1nc(OC(=O)c2c(Cl)cccc2Cl)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H11Cl2N3O4/c1-2-20-13-7-6-9(21(23)24)8-10(13)15(19-20)25-16(22)14-11(17)4-3-5-12(14)18/h3-8H,2H2,1H3 |
| InChIKey | KAYLUWQQXOLEBS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|