C22H14F3N3O5 — CID 110169703
[5-methoxy-1-[(3-nitrophenyl)methyl]indazol-3-yl] 2,4,6-trifluorobenzoate (PubChem CID 110169703) has the molecular formula C22H14F3N3O5 and a molecular weight of 457.36 g/mol. Its IUPAC name is [5-methoxy-1-[(3-nitrophenyl)methyl]indazol-3-yl] 2,4,6-trifluorobenzoate.
| Compound Name | [5-methoxy-1-[(3-nitrophenyl)methyl]indazol-3-yl] 2,4,6-trifluorobenzoate |
|---|---|
| PubChem CID | 110169703 |
| Molecular Formula | C22H14F3N3O5 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [5-methoxy-1-[(3-nitrophenyl)methyl]indazol-3-yl] 2,4,6-trifluorobenzoate |
| SMILES | COc1ccc2c(c1)c(OC(=O)c1c(F)cc(F)cc1F)nn2Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H14F3N3O5/c1-32-15-5-6-19-16(10-15)21(33-22(29)20-17(24)8-13(23)9-18(20)25)26-27(19)11-12-3-2-4-14(7-12)28(30)31/h2-10H,11H2,1H3 |
| InChIKey | USBZCDTYIBFJIR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|