C29H27Cl2N3O6 — CID 110169739
[5-methoxy-1-[[4-[(6-methoxy-6-oxohexanoyl)amino]phenyl]methyl]indazol-3-yl] 2,6-dichlorobenzoate (PubChem CID 110169739) has the molecular formula C29H27Cl2N3O6 and a molecular weight of 584.46 g/mol. Its IUPAC name is [5-methoxy-1-[[4-[(6-methoxy-6-oxohexanoyl)amino]phenyl]methyl]indazol-3-yl] 2,6-dichlorobenzoate.
| Compound Name | [5-methoxy-1-[[4-[(6-methoxy-6-oxohexanoyl)amino]phenyl]methyl]indazol-3-yl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 110169739 |
| Molecular Formula | C29H27Cl2N3O6 |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [5-methoxy-1-[[4-[(6-methoxy-6-oxohexanoyl)amino]phenyl]methyl]indazol-3-yl] 2,6-dichlorobenzoate |
| SMILES | COC(=O)CCCCC(=O)Nc1ccc(Cn2nc(OC(=O)c3c(Cl)cccc3Cl)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C29H27Cl2N3O6/c1-38-20-14-15-24-21(16-20)28(40-29(37)27-22(30)6-5-7-23(27)31)33-34(24)17-18-10-12-19(13-11-18)32-25(35)8-3-4-9-26(36)39-2/h5-7,10-16H,3-4,8-9,17H2,1-2H3,(H,32,35) |
| InChIKey | SMJQXPQERCYWOO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|