C23H17Cl2N3O6S — CID 110169691
[1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 4-acetamidobenzenesulfonate (PubChem CID 110169691) has the molecular formula C23H17Cl2N3O6S and a molecular weight of 534.38 g/mol. Its IUPAC name is [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 4-acetamidobenzenesulfonate.
| Compound Name | [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 110169691 |
| Molecular Formula | C23H17Cl2N3O6S |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc2c(c1)c(OS(=O)(=O)c1ccc(NC(C)=O)cc1)nn2C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O6S/c1-13(29)26-14-6-9-16(10-7-14)35(31,32)34-22-17-12-15(33-2)8-11-20(17)28(27-22)23(30)21-18(24)4-3-5-19(21)25/h3-12H,1-2H3,(H,26,29) |
| InChIKey | ADHZRPWVBDGRLT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|