C21H12Cl4N2O5S — CID 110169701
[1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 2,5-dichlorobenzenesulfonate (PubChem CID 110169701) has the molecular formula C21H12Cl4N2O5S and a molecular weight of 546.22 g/mol. Its IUPAC name is [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 2,5-dichlorobenzenesulfonate.
| Compound Name | [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 110169701 |
| Molecular Formula | C21H12Cl4N2O5S |
| Molecular Weight | 546.22 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | [1-(2,6-dichlorobenzoyl)-5-methoxyindazol-3-yl] 2,5-dichlorobenzenesulfonate |
| SMILES | COc1ccc2c(c1)c(OS(=O)(=O)c1cc(Cl)ccc1Cl)nn2C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H12Cl4N2O5S/c1-31-12-6-8-17-13(10-12)20(32-33(29,30)18-9-11(22)5-7-14(18)23)26-27(17)21(28)19-15(24)3-2-4-16(19)25/h2-10H,1H3 |
| InChIKey | BCOCVSCQCMQKSH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.22 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|