C16H14ClN3O2 — CID 156906964
1-(3-amino-5-methoxyindazol-1-yl)-2-(3-chlorophenyl)ethanone (PubChem CID 156906964) has the molecular formula C16H14ClN3O2 and a molecular weight of 315.76 g/mol. Its IUPAC name is 1-(3-amino-5-methoxyindazol-1-yl)-2-(3-chlorophenyl)ethanone.
| Compound Name | 1-(3-amino-5-methoxyindazol-1-yl)-2-(3-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 156906964 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(3-amino-5-methoxyindazol-1-yl)-2-(3-chlorophenyl)ethanone |
| SMILES | COc1ccc2c(c1)c(N)nn2C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClN3O2/c1-22-12-5-6-14-13(9-12)16(18)19-20(14)15(21)8-10-3-2-4-11(17)7-10/h2-7,9H,8H2,1H3,(H2,18,19) |
| InChIKey | ZQIQPTPKQRCWHN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |