C20H22ClN3O2 — CID 70337838
N-[(3-chlorophenyl)methyl]-2-(2-ethyl-5-methoxy-1H-indol-3-yl)acetohydrazide (PubChem CID 70337838) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-(2-ethyl-5-methoxy-1H-indol-3-yl)acetohydrazide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-(2-ethyl-5-methoxy-1H-indol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 70337838 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-(2-ethyl-5-methoxy-1H-indol-3-yl)acetohydrazide |
| SMILES | CCc1[nH]c2ccc(OC)cc2c1CC(=O)N(N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-3-18-17(16-10-15(26-2)7-8-19(16)23-18)11-20(25)24(22)12-13-5-4-6-14(21)9-13/h4-10,23H,3,11-12,22H2,1-2H3 |
| InChIKey | FTNFSOPDSHGXRD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|